CAS 1251950-58-9 is the registry number for 5-[(2,4-Difluorophenyl)methyl]-1,3,4-oxadiazol-2-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-[(2,4-difluorophenyl)methyl]-3H-1,3,4-oxadiazol-2-one (CAS 1251950-58-9) is a chemical compound with the molecular formula C9H6F2N2O2 and a molecular weight of 212.15 g/mol. IUPAC name: 5-[(2,4-difluorophenyl)methyl]-3H-1,3,4-oxadiazol-2-one. InChIKey: GLFFKBACPQWXCX-UHFFFAOYSA-N.
| Molecular formula | C9H6F2N2O2 |
|---|---|
| Molecular weight | 212.15 g/mol |
| IUPAC name | 5-[(2,4-difluorophenyl)methyl]-3H-1,3,4-oxadiazol-2-one |
| InChIKey | GLFFKBACPQWXCX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)CC2=NNC(=O)O2 |
Computed by PubChem (NCBI)