CAS 1566348-52-4 is the registry number for Methyl 4,5-difluoro-1H-benzo[d]imidazole-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4,5-difluoro-1H-benzimidazole-2-carboxylate (CAS 1566348-52-4) is a chemical compound with the molecular formula C9H6F2N2O2 and a molecular weight of 212.15 g/mol. IUPAC name: methyl 4,5-difluoro-1H-benzimidazole-2-carboxylate. InChIKey: YHFSNHPZHYCRAY-UHFFFAOYSA-N.
| Molecular formula | C9H6F2N2O2 |
|---|---|
| Molecular weight | 212.15 g/mol |
| IUPAC name | methyl 4,5-difluoro-1H-benzimidazole-2-carboxylate |
| InChIKey | YHFSNHPZHYCRAY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC2=C(N1)C=CC(=C2F)F |
Computed by PubChem (NCBI)