Products 1628915-69-4
CAS 1628915-69-4 is the registry number for Methyl 5-cyano-3-(difluoromethyl)picolinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-cyano-3-(difluoromethyl)pyridine-2-carboxylate (CAS 1628915-69-4) is a chemical compound with the molecular formula C9H6F2N2O2 and a molecular weight of 212.15 g/mol. IUPAC name: methyl 5-cyano-3-(difluoromethyl)pyridine-2-carboxylate. InChIKey: WZBZQOCDOSFNTJ-UHFFFAOYSA-N.
| Molecular formula | C9H6F2N2O2 |
|---|---|
| Molecular weight | 212.15 g/mol |
| IUPAC name | methyl 5-cyano-3-(difluoromethyl)pyridine-2-carboxylate |
| InChIKey | WZBZQOCDOSFNTJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=N1)C#N)C(F)F |
Computed by PubChem (NCBI)