CAS 1246616-66-9 appears in our catalog under these names: Dimethyl 3–(benzyloxy)–4–oxo–4H–pyran–2,5–dicarboxylate, Dimethyl 3-(benzyloxy)-4-oxo-4H-pyran-2,5-dicarboxylate 97%, 4H-Pyran-2,5-dicarboxylic acid, 4-oxo-3-(phenylmethoxy)-, 2,5-dimethyl ester, 98%, 98%, DIMETHYL 3-(BENZYLOXY)-4-OXO-4H-PYRAN-2,5-DICARBOXYLATE, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 100g, 10g, 50g, 500g.
Dimethyl 4-oxo-3-phenylmethoxypyran-2,5-dicarboxylate (CAS 1246616-66-9) is a chemical compound with the molecular formula C16H14O7 and a molecular weight of 318.28 g/mol. IUPAC name: dimethyl 4-oxo-3-phenylmethoxypyran-2,5-dicarboxylate. InChIKey: REVROVKRCYLCAT-UHFFFAOYSA-N.
| Molecular formula | C16H14O7 |
|---|---|
| Molecular weight | 318.28 g/mol |
| IUPAC name | dimethyl 4-oxo-3-phenylmethoxypyran-2,5-dicarboxylate |
| InChIKey | REVROVKRCYLCAT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=COC(=C(C1=O)OCC2=CC=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)