Products 140694-62-8
CAS 140694-62-8 appears in our catalog under these names: 3–epi–Padmatin, 3-epi-Padmatin, ≥95%, ≥95%, 3-epi-Padmatin. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1 mg, 5 mg.
(2R,3S)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-7-methoxy-2,3-dihydrochromen-4-one (CAS 140694-62-8) is a chemical compound with the molecular formula C16H14O7 and a molecular weight of 318.28 g/mol. IUPAC name: (2R,3S)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-7-methoxy-2,3-dihydrochromen-4-one. InChIKey: MRPJBTFHICBFNE-HZPDHXFCSA-N.
| Molecular formula | C16H14O7 |
|---|---|
| Molecular weight | 318.28 g/mol |
| IUPAC name | (2R,3S)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-7-methoxy-2,3-dihydrochromen-4-one |
| InChIKey | MRPJBTFHICBFNE-HZPDHXFCSA-N |
| SMILES | COC1=CC(=C2C(=C1)O[C@@H]([C@@H](C2=O)O)C3=CC(=C(C=C3)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
3-epi-Padmatin, orb1941411