Products 773850-91-2
CAS 773850-91-2 is the registry number for Drimiopsin D. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg, 50mg, Get quote.
1,3,6-trihydroxy-2,5-dimethoxy-8-methylxanthen-9-one (CAS 773850-91-2) is a chemical compound with the molecular formula C16H14O7 and a molecular weight of 318.28 g/mol. IUPAC name: 1,3,6-trihydroxy-2,5-dimethoxy-8-methylxanthen-9-one. InChIKey: PWBCXOKCVLBBMI-UHFFFAOYSA-N.
| Molecular formula | C16H14O7 |
|---|---|
| Molecular weight | 318.28 g/mol |
| IUPAC name | 1,3,6-trihydroxy-2,5-dimethoxy-8-methylxanthen-9-one |
| InChIKey | PWBCXOKCVLBBMI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C2=C1C(=O)C3=C(O2)C=C(C(=C3O)OC)O)OC)O |
Computed by PubChem (NCBI)