Products 916210-79-2
CAS 916210-79-2 appears in our catalog under these names: 3，6–Dihydroxy–1，2，7–trimethoxyxanthone, 3,6-Dihydroxy-1,2,7-trimethoxyxanthone. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
3,6-dihydroxy-1,2,7-trimethoxyxanthen-9-one (CAS 916210-79-2) is a chemical compound with the molecular formula C16H14O7 and a molecular weight of 318.28 g/mol. IUPAC name: 3,6-dihydroxy-1,2,7-trimethoxyxanthen-9-one. InChIKey: CAFZLSJOANEDGR-UHFFFAOYSA-N.
| Molecular formula | C16H14O7 |
|---|---|
| Molecular weight | 318.28 g/mol |
| IUPAC name | 3,6-dihydroxy-1,2,7-trimethoxyxanthen-9-one |
| InChIKey | CAFZLSJOANEDGR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)C3=C(O2)C=C(C(=C3OC)OC)O)O |
Computed by PubChem (NCBI)