Products 2055882-22-7
CAS 2055882-22-7 appears in our catalog under these names: Pterocarpadiol C, Pterocarpadiol C. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
(1S,12R,13S)-1,13-dihydroxy-5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,17-tetraen-16-one (CAS 2055882-22-7) is a chemical compound with the molecular formula C16H14O7 and a molecular weight of 318.28 g/mol. IUPAC name: (1S,12R,13S)-1,13-dihydroxy-5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,17-tetraen-16-one. InChIKey: UQXCWJTUYMGOHA-ARFHVFGLSA-N.
| Molecular formula | C16H14O7 |
|---|---|
| Molecular weight | 318.28 g/mol |
| IUPAC name | (1S,12R,13S)-1,13-dihydroxy-5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,17-tetraen-16-one |
| InChIKey | UQXCWJTUYMGOHA-ARFHVFGLSA-N |
| SMILES | C1C[C@@]2([C@H]3[C@@](COC2=CC1=O)(C4=CC5=C(C=C4O3)OCO5)O)O |
Computed by PubChem (NCBI)
Synonyms:
Pterocarpadiol C, orb1681835