Products 1246616-86-3

CAS 1246616-86-3 is the registry number for Diethyl 3-(benzyloxy)-4-oxo-4H-pyran-2,5-dicarboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Diethyl 4-oxo-3-phenylmethoxypyran-2,5-dicarboxylate (CAS 1246616-86-3) is a chemical compound with the molecular formula C18H18O7 and a molecular weight of 346.3 g/mol. IUPAC name: diethyl 4-oxo-3-phenylmethoxypyran-2,5-dicarboxylate. InChIKey: LREWATWZRHZOFH-UHFFFAOYSA-N.

Identity
Molecular formulaC18H18O7
Molecular weight346.3 g/mol
IUPAC namediethyl 4-oxo-3-phenylmethoxypyran-2,5-dicarboxylate
InChIKeyLREWATWZRHZOFH-UHFFFAOYSA-N
SMILESCCOC(=O)C1=COC(=C(C1=O)OCC2=CC=CC=C2)C(=O)OCC

Computed by PubChem (NCBI)