CAS 19132-91-3 appears in our catalog under these names: 4-Biphenylyl Glucuronide, >95% (HPLC), 4-Hydroxy Biphenyl O-Glucuronide Sodium Salt, 4-Hydroxy Biphenyl-d5 O-Glucuronide Sodium Salt. Offered by: TRC, Chemat Brand. Available pack sizes: 250mg, 25mg, on request.
(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-phenylphenoxy)oxane-2-carboxylic acid (CAS 19132-91-3) is a chemical compound with the molecular formula C18H18O7 and a molecular weight of 346.3 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-phenylphenoxy)oxane-2-carboxylic acid. InChIKey: RFZQPUBFBMWPMZ-RNGZQALNSA-N.
| Molecular formula | C18H18O7 |
|---|---|
| Molecular weight | 346.3 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-phenylphenoxy)oxane-2-carboxylic acid |
| InChIKey | RFZQPUBFBMWPMZ-RNGZQALNSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)C(=O)O)O)O)O |
Computed by PubChem (NCBI)