Products 24824-54-2
CAS 24824-54-2 appears in our catalog under these names: 3,4-Dimethoxybenzoic acid anhydride, 95%, 3,4-Dimethoxybenzoic anhydride, 97%, 3,4-Dimethoxybenzoic acid anhydride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 50g, 100g.
(3,4-dimethoxybenzoyl) 3,4-dimethoxybenzoate (CAS 24824-54-2) is a chemical compound with the molecular formula C18H18O7 and a molecular weight of 346.3 g/mol. IUPAC name: (3,4-dimethoxybenzoyl) 3,4-dimethoxybenzoate. InChIKey: PJZFUQAHDYSNLZ-UHFFFAOYSA-N.
| Molecular formula | C18H18O7 |
|---|---|
| Molecular weight | 346.3 g/mol |
| IUPAC name | (3,4-dimethoxybenzoyl) 3,4-dimethoxybenzoate |
| InChIKey | PJZFUQAHDYSNLZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)OC(=O)C2=CC(=C(C=C2)OC)OC)OC |
Computed by PubChem (NCBI)