CAS 31016-74-7 appears in our catalog under these names: o-Phenylphenol Glucuronide, o-Phenylphenol-glucuronide. Offered by: TRC, Biosynth, HPC Standards. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 1x10mg.
(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(2-phenylphenoxy)oxane-2-carboxylic acid (CAS 31016-74-7) is a chemical compound with the molecular formula C18H18O7 and a molecular weight of 346.3 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(2-phenylphenoxy)oxane-2-carboxylic acid. InChIKey: AKSKFIDXFDAABG-RNGZQALNSA-N.
| Molecular formula | C18H18O7 |
|---|---|
| Molecular weight | 346.3 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(2-phenylphenoxy)oxane-2-carboxylic acid |
| InChIKey | AKSKFIDXFDAABG-RNGZQALNSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)C(=O)O)O)O)O |
Computed by PubChem (NCBI)