Products 20516-19-2
CAS 20516-19-2 appears in our catalog under these names: Qianhucoumarin D, ≥98%, ≥98%, Qianhucoumarin D. Offered by: Chemat, MedChemExpress. Available pack sizes: 5mg, 10 mg, 5 mg, 1 mg.
[(9S,10S)-9-acetyloxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] acetate (CAS 20516-19-2) is a chemical compound with the molecular formula C18H18O7 and a molecular weight of 346.3 g/mol. IUPAC name: [(9S,10S)-9-acetyloxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] acetate. InChIKey: YJOWXMGENDGFDH-IRXDYDNUSA-N.
| Molecular formula | C18H18O7 |
|---|---|
| Molecular weight | 346.3 g/mol |
| IUPAC name | [(9S,10S)-9-acetyloxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] acetate |
| InChIKey | YJOWXMGENDGFDH-IRXDYDNUSA-N |
| SMILES | CC(=O)O[C@@H]1[C@@H](C(OC2=C1C3=C(C=C2)C=CC(=O)O3)(C)C)OC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
Qianhucoumarin D, orb1943432