CAS 1246643-15-1 is the registry number for 3-(S) tert-Butyl 3-(N,N-Dimethylaminomethyl)pyrrolidine Carbamate Hydrochloride. Offered by: TRC. Available pack sizes: 250mg.
Tert-butyl (3S)-3-[(dimethylamino)methyl]pyrrolidine-1-carboxylate;hydrochloride (CAS 1246643-15-1) is a chemical compound with the molecular formula C12H25ClN2O2 and a molecular weight of 264.79 g/mol. IUPAC name: tert-butyl (3S)-3-[(dimethylamino)methyl]pyrrolidine-1-carboxylate;hydrochloride. InChIKey: VMAMYHJAFNEBOM-PPHPATTJSA-N.
| Molecular formula | C12H25ClN2O2 |
|---|---|
| Molecular weight | 264.79 g/mol |
| IUPAC name | tert-butyl (3S)-3-[(dimethylamino)methyl]pyrrolidine-1-carboxylate;hydrochloride |
| InChIKey | VMAMYHJAFNEBOM-PPHPATTJSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C1)CN(C)C.Cl |
Computed by PubChem (NCBI)