Products 1246812-57-6
CAS 1246812-57-6 is the registry number for Bupropion ThioMorpholine Acid. Offered by: Chemat Brand. Available pack sizes: on request.
(3R)-6-(3-chlorophenyl)-6-hydroxy-5-methylthiomorpholine-3-carboxylic acid (CAS 1246812-57-6) is a chemical compound with the molecular formula C12H14ClNO3S and a molecular weight of 287.76 g/mol. IUPAC name: (3R)-6-(3-chlorophenyl)-6-hydroxy-5-methylthiomorpholine-3-carboxylic acid. InChIKey: NUKIHEHYUSKICU-HLIOBJQSSA-N.
| Molecular formula | C12H14ClNO3S |
|---|---|
| Molecular weight | 287.76 g/mol |
| IUPAC name | (3R)-6-(3-chlorophenyl)-6-hydroxy-5-methylthiomorpholine-3-carboxylic acid |
| InChIKey | NUKIHEHYUSKICU-HLIOBJQSSA-N |
| SMILES | CC1C(SC[C@H](N1)C(=O)O)(C2=CC(=CC=C2)Cl)O |
Computed by PubChem (NCBI)