CAS 2930824-91-0 is the registry number for 2-Isopropyl-3-oxo-1,2,3,4-tetrahydroisoquinoline-6-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-oxo-2-propan-2-yl-1,4-dihydroisoquinoline-6-sulfonyl chloride (CAS 2930824-91-0) is a chemical compound with the molecular formula C12H14ClNO3S and a molecular weight of 287.76 g/mol. IUPAC name: 3-oxo-2-propan-2-yl-1,4-dihydroisoquinoline-6-sulfonyl chloride. InChIKey: MGSDGBAIUIOYLN-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO3S |
|---|---|
| Molecular weight | 287.76 g/mol |
| IUPAC name | 3-oxo-2-propan-2-yl-1,4-dihydroisoquinoline-6-sulfonyl chloride |
| InChIKey | MGSDGBAIUIOYLN-UHFFFAOYSA-N |
| SMILES | CC(C)N1CC2=C(CC1=O)C=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)