Products 861212-71-7
CAS 861212-71-7 is the registry number for 6-(4-Chlorobenzenesulfonyl)-1-oxa-6-azaspiro[2.5]octane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
6-(4-chlorophenyl)sulfonyl-1-oxa-6-azaspiro[2.5]octane (CAS 861212-71-7) is a chemical compound with the molecular formula C12H14ClNO3S and a molecular weight of 287.76 g/mol. IUPAC name: 6-(4-chlorophenyl)sulfonyl-1-oxa-6-azaspiro[2.5]octane. InChIKey: MJCCEIXTLSRFSF-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO3S |
|---|---|
| Molecular weight | 287.76 g/mol |
| IUPAC name | 6-(4-chlorophenyl)sulfonyl-1-oxa-6-azaspiro[2.5]octane |
| InChIKey | MJCCEIXTLSRFSF-UHFFFAOYSA-N |
| SMILES | C1CN(CCC12CO2)S(=O)(=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)