Products 1248566-14-4
CAS 1248566-14-4 appears in our catalog under these names: 1,3,3,7-tetramethyl-2-oxo-2,3-dihydro-1h-indole-5-sulfonyl chloride, 95%, 1,3,3,7-Tetramethyl-2-oxoindoline-5-sulfonyl chloride, 98%, 1,3,3,7-Tetramethyl-2-oxo-2,3-dihydro-1H-indole-5-sulfonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
1,3,3,7-tetramethyl-2-oxoindole-5-sulfonyl chloride (CAS 1248566-14-4) is a chemical compound with the molecular formula C12H14ClNO3S and a molecular weight of 287.76 g/mol. IUPAC name: 1,3,3,7-tetramethyl-2-oxoindole-5-sulfonyl chloride. InChIKey: PGYGONAAWUTVDN-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO3S |
|---|---|
| Molecular weight | 287.76 g/mol |
| IUPAC name | 1,3,3,7-tetramethyl-2-oxoindole-5-sulfonyl chloride |
| InChIKey | PGYGONAAWUTVDN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1N(C(=O)C2(C)C)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)