Products 2133460-42-9
CAS 2133460-42-9 appears in our catalog under these names: Bupropion Impurity 11 ((3S,5S,6S)-Bupropion Impurity), Bupropion Impurity S, Bupropion Impurity 17, Bupropion Impurity 11, (3S,5S,6S)-Bupropion impurity. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 0,002g, 0,001g.
(3S,5S,6S)-6-(3-chlorophenyl)-6-hydroxy-5-methylthiomorpholine-3-carboxylic acid (CAS 2133460-42-9) is a chemical compound with the molecular formula C12H14ClNO3S and a molecular weight of 287.76 g/mol. IUPAC name: (3S,5S,6S)-6-(3-chlorophenyl)-6-hydroxy-5-methylthiomorpholine-3-carboxylic acid. InChIKey: NUKIHEHYUSKICU-HNBZJPLGSA-N.
| Molecular formula | C12H14ClNO3S |
|---|---|
| Molecular weight | 287.76 g/mol |
| IUPAC name | (3S,5S,6S)-6-(3-chlorophenyl)-6-hydroxy-5-methylthiomorpholine-3-carboxylic acid |
| InChIKey | NUKIHEHYUSKICU-HNBZJPLGSA-N |
| SMILES | C[C@H]1[C@@](SC[C@@H](N1)C(=O)O)(C2=CC(=CC=C2)Cl)O |
Computed by PubChem (NCBI)