Products 1246814-52-7
CAS 1246814-52-7 appears in our catalog under these names: rac-Clopidogrel EP Impurity A-d4 (rac-Clopidogrel-d4 Carboxylic Acid), rac-Clopidogrel-d4 Carboxylic Acid, >95% (HPLC), (Rac)-Clopidogrel carboxylic acid-d4, 99.51%. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg.
2-(2-chloro-3,4,5,6-tetradeuteriophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetic acid (CAS 1246814-52-7) is a chemical compound with the molecular formula C15H14ClNO2S and a molecular weight of 311.8 g/mol. IUPAC name: 2-(2-chloro-3,4,5,6-tetradeuteriophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetic acid. InChIKey: DCASRSISIKYPDD-RHQRLBAQSA-N.
| Molecular formula | C15H14ClNO2S |
|---|---|
| Molecular weight | 311.8 g/mol |
| IUPAC name | 2-(2-chloro-3,4,5,6-tetradeuteriophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetic acid |
| InChIKey | DCASRSISIKYPDD-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(C(=O)O)N2CCC3=C(C2)C=CS3)Cl)[2H])[2H] |
Computed by PubChem (NCBI)