Products 90280-12-9
CAS 90280-12-9 appears in our catalog under these names: 4–chloro Modafinil, 4-Chloro modafinil. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg, 5 mg.
2-[(4-chlorophenyl)-phenylmethyl]sulfinylacetamide (CAS 90280-12-9) is a chemical compound with the molecular formula C15H14ClNO2S and a molecular weight of 307.8 g/mol. IUPAC name: 2-[(4-chlorophenyl)-phenylmethyl]sulfinylacetamide. InChIKey: FIGLGVNEBPKAKG-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO2S |
|---|---|
| Molecular weight | 307.8 g/mol |
| IUPAC name | 2-[(4-chlorophenyl)-phenylmethyl]sulfinylacetamide |
| InChIKey | FIGLGVNEBPKAKG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=C(C=C2)Cl)S(=O)CC(=O)N |
Computed by PubChem (NCBI)