CAS 127168-77-8 is the registry number for 5-Chloro-2-tosylisoindoline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-chloro-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindole (CAS 127168-77-8) is a chemical compound with the molecular formula C15H14ClNO2S and a molecular weight of 307.8 g/mol. IUPAC name: 5-chloro-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindole. InChIKey: VXGIDBYTECOSJQ-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO2S |
|---|---|
| Molecular weight | 307.8 g/mol |
| IUPAC name | 5-chloro-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindole |
| InChIKey | VXGIDBYTECOSJQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC3=C(C2)C=C(C=C3)Cl |
Computed by PubChem (NCBI)