Products 200803-16-3
CAS 200803-16-3 is the registry number for N-Tosyl-2-(m-chlorophenyl)aziridine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
2-(3-chlorophenyl)-1-(4-methylphenyl)sulfonylaziridine (CAS 200803-16-3) is a chemical compound with the molecular formula C15H14ClNO2S and a molecular weight of 307.8 g/mol. IUPAC name: 2-(3-chlorophenyl)-1-(4-methylphenyl)sulfonylaziridine. InChIKey: FKGDBLFWVLGASP-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO2S |
|---|---|
| Molecular weight | 307.8 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-1-(4-methylphenyl)sulfonylaziridine |
| InChIKey | FKGDBLFWVLGASP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC2C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)