CAS 324757-50-8 appears in our catalog under these names: Thieno[3,2-c]pyridine-5(4H)-acetic acid, α-(2-chlorophenyl)-6,7-dihydro-, (αR)-, 98%, Clopidogrel Impurity 6, Clopidogrel EP Impurity A (R-Isomer) ((R)-Clopidogrel Carboxylic Acid), (αR)-α-(2-Chlorophenyl)-6,7-dihydrothieno[3,2-c]pyridine-5(4H)-acetic acid, 95%, 95%. Offered by: Chemat Brand, Hubei YoungXin, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 1g.
(2R)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetic acid (CAS 324757-50-8) is a chemical compound with the molecular formula C15H14ClNO2S and a molecular weight of 307.8 g/mol. IUPAC name: (2R)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetic acid. InChIKey: DCASRSISIKYPDD-CQSZACIVSA-N.
| Molecular formula | C15H14ClNO2S |
|---|---|
| Molecular weight | 307.8 g/mol |
| IUPAC name | (2R)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetic acid |
| InChIKey | DCASRSISIKYPDD-CQSZACIVSA-N |
| SMILES | C1CN(CC2=C1SC=C2)[C@H](C3=CC=CC=C3Cl)C(=O)O |
Computed by PubChem (NCBI)