CAS 1251763-08-2 appears in our catalog under these names: Sodium 4-Hydroxybutyrate-2,2,3,3-d4, 98 atom % D, min 98% Chemical Purity, Sodium 4-hydroxybutyrate-2,2,3,3-d4. Offered by: CDN, Biosynth. Available pack sizes: 0,1g, 25mg, 50mg, 100mg.
Sodium 2,2,3,3-tetradeuterio-4-hydroxybutanoate (CAS 1251763-08-2) is a chemical compound with the molecular formula C4H7NaO3 and a molecular weight of 130.11 g/mol. IUPAC name: sodium 2,2,3,3-tetradeuterio-4-hydroxybutanoate. InChIKey: XYGBKMMCQDZQOZ-PBCJVBLFSA-M.
| Molecular formula | C4H7NaO3 |
|---|---|
| Molecular weight | 130.11 g/mol |
| IUPAC name | sodium 2,2,3,3-tetradeuterio-4-hydroxybutanoate |
| InChIKey | XYGBKMMCQDZQOZ-PBCJVBLFSA-M |
| SMILES | [2H]C([2H])(CO)C([2H])([2H])C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)