CAS 1246815-16-6 is the registry number for Efaproxiral-d6. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 50mg, 25mg, 10 mg, 1 mg.
3,3,3-trideuterio-2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]-2-(trideuteriomethyl)propanoic acid (CAS 1246815-16-6) is a chemical compound with the molecular formula C20H23NO4 and a molecular weight of 347.4 g/mol. IUPAC name: 3,3,3-trideuterio-2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]-2-(trideuteriomethyl)propanoic acid. InChIKey: BNFRJXLZYUTIII-LIJFRPJRSA-N.
| Molecular formula | C20H23NO4 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | 3,3,3-trideuterio-2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]-2-(trideuteriomethyl)propanoic acid |
| InChIKey | BNFRJXLZYUTIII-LIJFRPJRSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)O)(C([2H])([2H])[2H])OC1=CC=C(C=C1)CC(=O)NC2=CC(=CC(=C2)C)C |
Computed by PubChem (NCBI)