CAS 131179-95-8 appears in our catalog under these names: Efaproxiral, >95% (HPLC), 2-(4-(2-((3,5-Dimethylphenyl)amino)-2-oxoethyl)phenoxy)-2-methylpropanoic acid, 95%, 95%, Efaproxiral, Efaproxiral (RSR13), Efaproxiral, 99.94%. Offered by: TRC, Chemat, TargetMol, GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 500mg, 1g, 10mg, 25mg, 50mg, 0,05g.
2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]-2-methylpropanoic acid (CAS 131179-95-8) is a chemical compound with the molecular formula C20H23NO4 and a molecular weight of 341.4 g/mol. IUPAC name: 2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]-2-methylpropanoic acid. InChIKey: BNFRJXLZYUTIII-UHFFFAOYSA-N.
| Molecular formula | C20H23NO4 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]-2-methylpropanoic acid |
| InChIKey | BNFRJXLZYUTIII-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)NC(=O)CC2=CC=C(C=C2)OC(C)(C)C(=O)O)C |
Computed by PubChem (NCBI)