CAS 1246815-21-3 appears in our catalog under these names: rac-erythro-Ethylphenidate Hydrochloride, L-erythro-Ethylphenidate Hydrochloride, rac-erythro-Ethylphenidate Hydrochloride (1.0mg/ml in Methanol), (alphaS,2R)-alpha-Phenyl-2-piperidineacetic Acid Ethyl Ester Hydrochloride. Offered by: TRC. Available pack sizes: 100mg, 10mg, 25mg, 1x1ml, 50mg.
Ethyl (2S)-2-phenyl-2-[(2R)-piperidin-2-yl]acetate;hydrochloride (CAS 1246815-21-3) is a chemical compound with the molecular formula C15H22ClNO2 and a molecular weight of 283.79 g/mol. IUPAC name: ethyl (2S)-2-phenyl-2-[(2R)-piperidin-2-yl]acetate;hydrochloride. InChIKey: ZNSNAOXTBUHNKX-DFQHDRSWSA-N.
| Molecular formula | C15H22ClNO2 |
|---|---|
| Molecular weight | 283.79 g/mol |
| IUPAC name | ethyl (2S)-2-phenyl-2-[(2R)-piperidin-2-yl]acetate;hydrochloride |
| InChIKey | ZNSNAOXTBUHNKX-DFQHDRSWSA-N |
| SMILES | CCOC(=O)[C@H]([C@H]1CCCCN1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)