CAS 851764-84-6 appears in our catalog under these names: D-threo-Ethylphenidate Hydrochloride, D-threo-Ethylphenidate Hydrochloride (1.0mg/ml in Methanol). Offered by: TRC. Available pack sizes: 50mg, 5mg, 1x1ml.
Ethyl (2R)-2-phenyl-2-[(2R)-piperidin-2-yl]acetate;hydrochloride (CAS 851764-84-6) is a chemical compound with the molecular formula C15H22ClNO2 and a molecular weight of 283.79 g/mol. IUPAC name: ethyl (2R)-2-phenyl-2-[(2R)-piperidin-2-yl]acetate;hydrochloride. InChIKey: ZNSNAOXTBUHNKX-DTPOWOMPSA-N.
| Molecular formula | C15H22ClNO2 |
|---|---|
| Molecular weight | 283.79 g/mol |
| IUPAC name | ethyl (2R)-2-phenyl-2-[(2R)-piperidin-2-yl]acetate;hydrochloride |
| InChIKey | ZNSNAOXTBUHNKX-DTPOWOMPSA-N |
| SMILES | CCOC(=O)[C@@H]([C@H]1CCCCN1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)