CAS 214149-46-9 appears in our catalog under these names: rac-threo-Ethylphenidate Hydrochloride, (±)–threo–Ethylphenidate (hydrochloride), (±)-Threo-ethylphenidate hydrochloride. Offered by: TRC, GLPBio, Biosynth. Available pack sizes: 100mg, 10mg, 5mg, 50mg, 25mg.
Ethyl (2S)-2-phenyl-2-[(2S)-piperidin-2-yl]acetate;hydrochloride (CAS 214149-46-9) is a chemical compound with the molecular formula C15H22ClNO2 and a molecular weight of 283.79 g/mol. IUPAC name: ethyl (2S)-2-phenyl-2-[(2S)-piperidin-2-yl]acetate;hydrochloride. InChIKey: ZNSNAOXTBUHNKX-IODNYQNNSA-N.
| Molecular formula | C15H22ClNO2 |
|---|---|
| Molecular weight | 283.79 g/mol |
| IUPAC name | ethyl (2S)-2-phenyl-2-[(2S)-piperidin-2-yl]acetate;hydrochloride |
| InChIKey | ZNSNAOXTBUHNKX-IODNYQNNSA-N |
| SMILES | CCOC(=O)[C@H]([C@@H]1CCCCN1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)