Products 1246817-36-6
CAS 1246817-36-6 appears in our catalog under these names: Deterenol-d7 Hydrochloride, >95% (HPLC), Deterenol-d7 hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 2,5mg, 25mg, 10mg, 50mg.
4-[2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-1-hydroxyethyl]phenol;hydrochloride (CAS 1246817-36-6) is a chemical compound with the molecular formula C11H18ClNO2 and a molecular weight of 238.76 g/mol. IUPAC name: 4-[2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-1-hydroxyethyl]phenol;hydrochloride. InChIKey: KTOGVIILDSYTNS-CZHLNGJYSA-N.
| Molecular formula | C11H18ClNO2 |
|---|---|
| Molecular weight | 238.76 g/mol |
| IUPAC name | 4-[2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-1-hydroxyethyl]phenol;hydrochloride |
| InChIKey | KTOGVIILDSYTNS-CZHLNGJYSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCC(C1=CC=C(C=C1)O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
Deterenol-d7 Hydrochloride, Deterenol-d