CAS 1247-97-8 appears in our catalog under these names: 3,5,7,3′,4′–Pentamethoxyflavone, 3,5,7,3′,4′-Pentamethoxyflavone/ 98.87% (existing batch purity), 3,3',4',5,7-Pentamethoxyflavone, 3,5,7,3′,4′-Pentamethoxyflavone, 98%, 98%, 3,5,7,3′,4′-Pentamethoxyflavone, 99.69%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 2mg, 0,005g, 0,01g, 0,025g, 0,05g.
2-(3,4-dimethoxyphenyl)-3,5,7-trimethoxychromen-4-one (CAS 1247-97-8) is a chemical compound with the molecular formula C20H20O7 and a molecular weight of 372.4 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)-3,5,7-trimethoxychromen-4-one. InChIKey: ALGDHWVALRSLBT-UHFFFAOYSA-N.
| Molecular formula | C20H20O7 |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)-3,5,7-trimethoxychromen-4-one |
| InChIKey | ALGDHWVALRSLBT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(O2)C=C(C=C3OC)OC)OC)OC |
Computed by PubChem (NCBI)