Products 1247057-55-1
CAS 1247057-55-1 appears in our catalog under these names: 5-Amino-2-(2,2,2-trifluoroethoxy)benzamide, 95%, 5-Amino-2-(2,2,2-trifluoroethoxy)benzamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-amino-2-(2,2,2-trifluoroethoxy)benzamide (CAS 1247057-55-1) is a chemical compound with the molecular formula C9H9F3N2O2 and a molecular weight of 234.17 g/mol. IUPAC name: 5-amino-2-(2,2,2-trifluoroethoxy)benzamide. InChIKey: JCZZNPQDFSEEHZ-UHFFFAOYSA-N.
| Molecular formula | C9H9F3N2O2 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | 5-amino-2-(2,2,2-trifluoroethoxy)benzamide |
| InChIKey | JCZZNPQDFSEEHZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C(=O)N)OCC(F)(F)F |
Computed by PubChem (NCBI)