Products 1247180-93-3

CAS 1247180-93-3 is the registry number for Methyl 1-(methylamino)cyclobutanecarboxylate hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.

Methyl 1-(methylamino)cyclobutane-1-carboxylate;hydrochloride (CAS 1247180-93-3) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: methyl 1-(methylamino)cyclobutane-1-carboxylate;hydrochloride. InChIKey: OVPVUBJLTLUDED-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClNO2
Molecular weight179.64 g/mol
IUPAC namemethyl 1-(methylamino)cyclobutane-1-carboxylate;hydrochloride
InChIKeyOVPVUBJLTLUDED-UHFFFAOYSA-N
SMILESCNC1(CCC1)C(=O)OC.Cl

Computed by PubChem (NCBI)