CAS 1247227-63-9 appears in our catalog under these names: (2,3-Dihydro-1,4-benzodioxin-5-yl)methanesulfonamide, 95%, (2,3-Dihydro-1,4-benzodioxin-5-yl)methanesulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,3-dihydro-1,4-benzodioxin-5-ylmethanesulfonamide (CAS 1247227-63-9) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxin-5-ylmethanesulfonamide. InChIKey: HIFNDRMNDYNQHC-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxin-5-ylmethanesulfonamide |
| InChIKey | HIFNDRMNDYNQHC-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=CC=C2O1)CS(=O)(=O)N |
Computed by PubChem (NCBI)