CAS 1247243-57-7 appears in our catalog under these names: N-(2-Sulfamoylphenyl)cyclopropanecarboxamide, 95%, N-(2-Sulfamoylphenyl)cyclopropanecarboxamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
N-(2-sulfamoylphenyl)cyclopropanecarboxamide (CAS 1247243-57-7) is a chemical compound with the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. IUPAC name: N-(2-sulfamoylphenyl)cyclopropanecarboxamide. InChIKey: VMQRRGDXYRBKPX-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3S |
|---|---|
| Molecular weight | 240.28 g/mol |
| IUPAC name | N-(2-sulfamoylphenyl)cyclopropanecarboxamide |
| InChIKey | VMQRRGDXYRBKPX-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)NC2=CC=CC=C2S(=O)(=O)N |
Computed by PubChem (NCBI)