Products 1247345-43-2

CAS 1247345-43-2 is the registry number for 3-(2-Ethylphenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(2-ethylphenyl)-2-oxopropanoic acid (CAS 1247345-43-2) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 3-(2-ethylphenyl)-2-oxopropanoic acid. InChIKey: YWHKGGPSVBLQJD-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12O3
Molecular weight192.21 g/mol
IUPAC name3-(2-ethylphenyl)-2-oxopropanoic acid
InChIKeyYWHKGGPSVBLQJD-UHFFFAOYSA-N
SMILESCCC1=CC=CC=C1CC(=O)C(=O)O

Computed by PubChem (NCBI)