Products 1247422-94-1
CAS 1247422-94-1 is the registry number for 4-Chloro-2-cyclopropylthieno[2,3-d]pyrimidine, 95%. Offered by: Fluorochem, Ambeed, BLDpharm, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-chloro-2-cyclopropylthieno[2,3-d]pyrimidine (CAS 1247422-94-1) is a chemical compound with the molecular formula C9H7ClN2S and a molecular weight of 210.68 g/mol. IUPAC name: 4-chloro-2-cyclopropylthieno[2,3-d]pyrimidine. InChIKey: RNHVQHFKLFHTHI-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2S |
|---|---|
| Molecular weight | 210.68 g/mol |
| IUPAC name | 4-chloro-2-cyclopropylthieno[2,3-d]pyrimidine |
| InChIKey | RNHVQHFKLFHTHI-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC3=C(C=CS3)C(=N2)Cl |
Computed by PubChem (NCBI)