CAS 1247447-23-9 is the registry number for 6-Cyclopropylmethoxy-3,4-dihydro-2h-naphthalen-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-(cyclopropylmethoxy)-3,4-dihydro-2H-naphthalen-1-one (CAS 1247447-23-9) is a chemical compound with the molecular formula C14H16O2 and a molecular weight of 216.27 g/mol. IUPAC name: 6-(cyclopropylmethoxy)-3,4-dihydro-2H-naphthalen-1-one. InChIKey: NKVOQNIXBKCSFA-UHFFFAOYSA-N.
| Molecular formula | C14H16O2 |
|---|---|
| Molecular weight | 216.27 g/mol |
| IUPAC name | 6-(cyclopropylmethoxy)-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | NKVOQNIXBKCSFA-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)OCC3CC3)C(=O)C1 |
Computed by PubChem (NCBI)