CAS 29638-71-9 is the registry number for 3-(3-Phenyl-2-propenyl)-2,4-pentanedione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-[(E)-3-phenylprop-2-enyl]pentane-2,4-dione (CAS 29638-71-9) is a chemical compound with the molecular formula C14H16O2 and a molecular weight of 216.27 g/mol. IUPAC name: 3-[(E)-3-phenylprop-2-enyl]pentane-2,4-dione. InChIKey: PGEPOVPAPVUGAJ-RMKNXTFCSA-N.
| Molecular formula | C14H16O2 |
|---|---|
| Molecular weight | 216.27 g/mol |
| IUPAC name | 3-[(E)-3-phenylprop-2-enyl]pentane-2,4-dione |
| InChIKey | PGEPOVPAPVUGAJ-RMKNXTFCSA-N |
| SMILES | CC(=O)C(C/C=C/C1=CC=CC=C1)C(=O)C |
Computed by PubChem (NCBI)