Products 202737-37-9
CAS 202737-37-9 appears in our catalog under these names: 2-Phenylspiro[3.3]heptane-2-carboxylic acid, 95%, 2-Phenylspiro(3.3)heptane-2-carboxylic acid, 97%, 2-Phenylspiro(3.3)heptane-2-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
2-phenylspiro[3.3]heptane-2-carboxylic acid (CAS 202737-37-9) is a chemical compound with the molecular formula C14H16O2 and a molecular weight of 216.27 g/mol. IUPAC name: 2-phenylspiro[3.3]heptane-2-carboxylic acid. InChIKey: GLAOKQHKICBDBX-UHFFFAOYSA-N.
| Molecular formula | C14H16O2 |
|---|---|
| Molecular weight | 216.27 g/mol |
| IUPAC name | 2-phenylspiro[3.3]heptane-2-carboxylic acid |
| InChIKey | GLAOKQHKICBDBX-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CC(C2)(C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)