CAS 68293-39-0 is the registry number for 2-(1,2,3,5,6,7-Hexahydro-s-indacen-4-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetic acid (CAS 68293-39-0) is a chemical compound with the molecular formula C14H16O2 and a molecular weight of 216.27 g/mol. IUPAC name: 2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetic acid. InChIKey: YMSAKLKEEFHGIJ-UHFFFAOYSA-N.
| Molecular formula | C14H16O2 |
|---|---|
| Molecular weight | 216.27 g/mol |
| IUPAC name | 2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetic acid |
| InChIKey | YMSAKLKEEFHGIJ-UHFFFAOYSA-N |
| SMILES | C1CC2=CC3=C(CCC3)C(=C2C1)CC(=O)O |
Computed by PubChem (NCBI)