Products 1255147-00-2
CAS 1255147-00-2 appears in our catalog under these names: 5-(4-Ethylphenyl)cyclohexane-1,3-dione, 95%, 5-(4-Ethylphenyl)cyclohexane-1,3-dione, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-(4-ethylphenyl)cyclohexane-1,3-dione (CAS 1255147-00-2) is a chemical compound with the molecular formula C14H16O2 and a molecular weight of 216.27 g/mol. IUPAC name: 5-(4-ethylphenyl)cyclohexane-1,3-dione. InChIKey: UWYXYUUAKSBXRP-UHFFFAOYSA-N.
| Molecular formula | C14H16O2 |
|---|---|
| Molecular weight | 216.27 g/mol |
| IUPAC name | 5-(4-ethylphenyl)cyclohexane-1,3-dione |
| InChIKey | UWYXYUUAKSBXRP-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2CC(=O)CC(=O)C2 |
Computed by PubChem (NCBI)