Products 1247517-44-7
CAS 1247517-44-7 is the registry number for 2-Cyclopropyl-3H,4H,5H,6H,7H-cyclopenta(D)pyrimidin-4-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-cyclopropyl-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one (CAS 1247517-44-7) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: 2-cyclopropyl-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one. InChIKey: HRFUMFZRYZHYEJ-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 2-cyclopropyl-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one |
| InChIKey | HRFUMFZRYZHYEJ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)N=C(NC2=O)C3CC3 |
Computed by PubChem (NCBI)