CAS 1247878-30-3 appears in our catalog under these names: (2,4-Dimethylphenyl)(isocyano)methyl 4-methylphenyl sulfone, 98%, (2,4–DImethylphenyl)(isocyano)methyl 4–methylphenyl sulfone, (2,4-DImethylphenyl)(isocyano)methyl 4-methylphenyl sulfone, 98%, 98%, 1-(Isocyano(tosyl)methyl)-2,4-dimethylbenzene, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
1-[isocyano-(4-methylphenyl)sulfonylmethyl]-2,4-dimethylbenzene (CAS 1247878-30-3) is a chemical compound with the molecular formula C17H17NO2S and a molecular weight of 299.4 g/mol. IUPAC name: 1-[isocyano-(4-methylphenyl)sulfonylmethyl]-2,4-dimethylbenzene. InChIKey: GGEVCMLDVLELSH-UHFFFAOYSA-N.
| Molecular formula | C17H17NO2S |
|---|---|
| Molecular weight | 299.4 g/mol |
| IUPAC name | 1-[isocyano-(4-methylphenyl)sulfonylmethyl]-2,4-dimethylbenzene |
| InChIKey | GGEVCMLDVLELSH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C(C2=C(C=C(C=C2)C)C)[N+]#[C-] |
Computed by PubChem (NCBI)