Products 170653-70-0

CAS 170653-70-0 is the registry number for tert-Butyl dibenzo[b,d]thiophen-4-ylcarbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Tert-butyl N-dibenzothiophen-4-ylcarbamate (CAS 170653-70-0) is a chemical compound with the molecular formula C17H17NO2S and a molecular weight of 299.4 g/mol. IUPAC name: tert-butyl N-dibenzothiophen-4-ylcarbamate. InChIKey: IPFDGYZSZTZRGS-UHFFFAOYSA-N.

Identity
Molecular formulaC17H17NO2S
Molecular weight299.4 g/mol
IUPAC nametert-butyl N-dibenzothiophen-4-ylcarbamate
InChIKeyIPFDGYZSZTZRGS-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=CC=CC2=C1SC3=CC=CC=C23

Computed by PubChem (NCBI)