CAS 257288-48-5 appears in our catalog under these names: H-D-Cys(Fm)-OH, (S)-3-(((9H-Fluoren-9-yl)methyl)thio)-2-aminopropanoic acid, 97%, S-(9H-Fluoren-9-ylmethyl)-D-cysteine, 98%, 98%. Offered by: Creative Peptides, AmBeed, Chemat. Available pack sizes: 1g, 5g, 250mg.
(2S)-2-amino-3-(9H-fluoren-9-ylmethylsulfanyl)propanoic acid (CAS 257288-48-5) is a chemical compound with the molecular formula C17H17NO2S and a molecular weight of 299.4 g/mol. IUPAC name: (2S)-2-amino-3-(9H-fluoren-9-ylmethylsulfanyl)propanoic acid. InChIKey: SFRBQYRAZQGDPW-MRXNPFEDSA-N.
| Molecular formula | C17H17NO2S |
|---|---|
| Molecular weight | 299.4 g/mol |
| IUPAC name | (2S)-2-amino-3-(9H-fluoren-9-ylmethylsulfanyl)propanoic acid |
| InChIKey | SFRBQYRAZQGDPW-MRXNPFEDSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)CSC[C@H](C(=O)O)N |
Computed by PubChem (NCBI)