CAS 375359-94-7 appears in our catalog under these names: 2,2,4-Trimethyl-1,2-dihydroquinolin-6-yl thiophene-2-carboxylate, 95%, 2,2,4-Trimethyl-1,2-dihydroquinolin-6-yl thiophene-2-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(2,2,4-trimethyl-1H-quinolin-6-yl) thiophene-2-carboxylate (CAS 375359-94-7) is a chemical compound with the molecular formula C17H17NO2S and a molecular weight of 299.4 g/mol. IUPAC name: (2,2,4-trimethyl-1H-quinolin-6-yl) thiophene-2-carboxylate. InChIKey: QUZPIEFRIXWLQW-UHFFFAOYSA-N.
| Molecular formula | C17H17NO2S |
|---|---|
| Molecular weight | 299.4 g/mol |
| IUPAC name | (2,2,4-trimethyl-1H-quinolin-6-yl) thiophene-2-carboxylate |
| InChIKey | QUZPIEFRIXWLQW-UHFFFAOYSA-N |
| SMILES | CC1=CC(NC2=C1C=C(C=C2)OC(=O)C3=CC=CS3)(C)C |
Computed by PubChem (NCBI)