CAS 84888-38-0 appears in our catalog under these names: H–Cys(Fm)–OH, H-Cys(Fm)-OH. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 25g, 5g, 10g.
(2R)-2-amino-3-(9H-fluoren-9-ylmethylsulfanyl)propanoic acid (CAS 84888-38-0) is a chemical compound with the molecular formula C17H17NO2S and a molecular weight of 299.4 g/mol. IUPAC name: (2R)-2-amino-3-(9H-fluoren-9-ylmethylsulfanyl)propanoic acid. InChIKey: SFRBQYRAZQGDPW-INIZCTEOSA-N.
| Molecular formula | C17H17NO2S |
|---|---|
| Molecular weight | 299.4 g/mol |
| IUPAC name | (2R)-2-amino-3-(9H-fluoren-9-ylmethylsulfanyl)propanoic acid |
| InChIKey | SFRBQYRAZQGDPW-INIZCTEOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)CSC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)