CAS 1247986-89-5 appears in our catalog under these names: 4-(2-Fluorophenyl)oxazol-2-amine, 95%, 4-(2-Fluorophenyl)-1,3-oxazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-(2-fluorophenyl)-1,3-oxazol-2-amine (CAS 1247986-89-5) is a chemical compound with the molecular formula C9H7FN2O and a molecular weight of 178.16 g/mol. IUPAC name: 4-(2-fluorophenyl)-1,3-oxazol-2-amine. InChIKey: UALJWFVYXIGPHQ-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2O |
|---|---|
| Molecular weight | 178.16 g/mol |
| IUPAC name | 4-(2-fluorophenyl)-1,3-oxazol-2-amine |
| InChIKey | UALJWFVYXIGPHQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=COC(=N2)N)F |
Computed by PubChem (NCBI)